| Customization: | Available |
|---|---|
| CAS No.: | 17639-93-9 |
| Formula: | C4h7clo2 |
Suppliers with verified business licenses
Audited Supplier Audited by an independent third-party inspection agency
Get in touch with me:
| Name | Methyl 2-chloropropionate |
| Synonyms | CH3CHClC(O)OCH3 Methyl 2-chloropropi 2-chloropropyl Methyl Methyl 2-chloropropion Methyl 2-chloropropiote Mehyl 2-chloropropionate Methyl 2-chloropropionate methyl 2-chloropropanoate methyl 3-chloropropanoate 2- chloroMethyl propionate 2-chloro-2-methylpropanoate Methyl alpha-chloropropionate methyl (2S)-2-chloropropanoate 2-chloro-propionicacimethylester 2-chloro-propanoicacimethylester Propionic acid, 2-chloro-, methyl ester Propanoic acid, 2-chloro-, methyl ester alpha-Chloropropionic acid methyl ester |
| CAS | 17639-93-9 |
| EINECS | 241-624-5 |
| InChI | InChI=1/C4H7ClO2/c1-7-4(6)2-3-5/h2-3H2,1H3 |
| Molecular Formula | C4H7ClO2 |
| Molar Mass | 122.55 |
| Density | 1.075g/mLat 25°C(lit.) |
| Melting Point | -10 °C |
| Boling Point | 132-133°C(lit.) |
| Flash Point | 101°F |
| Water Solubility | immiscible |
| Vapor Presure | 5.25 mm Hg ( 20 °C) |
| Vapor Density | 4.22 (vs air) |
| Appearance | clear liquid |
| Specific Gravity | 1.075 |
| Color | Colorless to Almost colorless |
| BRN | 1421535 |
| PH | 6-7 (H2O, 20ºC) |
| Storage Condition | Store at +5°C to +30°C. |
| Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Explosive Limit | 2.8-13.9%(V) |
| Refractive Index | n20/D 1.417(lit.) |
| Physical and Chemical Properties | Density 1.075 melting point -10°C boiling point 132-133°C refractive index 1.416-1.419 flash point 38°C water-soluble immiscible |
| Use | Used as an intermediate of pesticide, medicine and perfume |
){kind=link}