| Customization: | Available |
|---|---|
| CAS No.: | 95-92-1 |
| Formula: | C6h10o4 |
Suppliers with verified business licenses
Audited Supplier Audited by an independent third-party inspection agency
Get in touch with me:
| Name | Diethyl oxalate |
| Synonyms | ETHYL OXALATE Ethyl oxalate C2H5OCOCOOC2H5 Diethyl oxalate DIETHYL OXALATE AKOS BBS-00004457 RARECHEM AL BI 0114 diethyl ethanedioate DIETHYL ETHANEDIOATE OXALIC ACID DIETHYL ESTER Oxalic acid diethyl ester Ethanedioic acid diethyl ester |
| CAS | 95-92-1 |
| EINECS | 202-464-1 |
| InChI | InChI=1/C6H10O4/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3 |
| InChIKey | WYACBZDAHNBPPB-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
| Molar Mass | 146.14 |
| Density | 1.076 g/mL at 25 °C (lit.) |
| Melting Point | -41 °C (lit.) |
| Boling Point | 185 °C (lit.) |
| Flash Point | 168°F |
| Water Solubility | MAY DECOMPOSE |
| Solubility | Miscible with alcohols, ether and other common organic solvents. |
| Vapor Presure | 1 mm Hg ( 47 °C) |
| Vapor Density | 5.03 (vs air) |
| Appearance | Liquid |
| Color | Clear |
| Merck | 14,3125 |
| BRN | 606350 |
| Storage Condition | Store below +30°C. |
| Stability | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| Sensitive | Moisture Sensitive |
| Explosive Limit | 0.42-2.67%(V) |
| Refractive Index | n20/D 1.410(lit.) |
| Physical and Chemical Properties | Colorless oily liquid with aromatic odor. melting point -40.6 ºC boiling point 185.4 ºC relative density 1.0785 refractive index 1.4101 solubility miscible with common solvents such as ethanol, ether and acetone. Slightly soluble in water. |
| Use | As a drug phenobarbital, azathioprine, solid sulfonamide intermediates and plastic accelerator |
){kind=link}